C46H34F4O9S2 — CID 140904199
1,1,2,2-tetrafluoro-2-[3-[4-(4-methylphenyl)phenoxy]-5-[4-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]phenoxy]phenoxy]ethanesulfonic acid (PubChem CID 140904199) has the molecular formula C46H34F4O9S2 and a molecular weight of 870.90 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[3-[4-(4-methylphenyl)phenoxy]-5-[4-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]phenoxy]phenoxy]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[3-[4-(4-methylphenyl)phenoxy]-5-[4-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]phenoxy]phenoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 140904199 |
| Molecular Formula | C46H34F4O9S2 |
| Molecular Weight | 870.90 g/mol |
| Exact Mass | 870.16 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[3-[4-(4-methylphenyl)phenoxy]-5-[4-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]phenoxy]phenoxy]ethanesulfonic acid |
| SMILES | Cc1ccc(-c2ccc(Oc3cc(Oc4ccc(-c5ccc(Oc6ccc(S(=O)(=O)c7ccc(C)cc7)cc6)cc5)cc4)cc(OC(F)(F)C(F)(F)S(=O)(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C46H34F4O9S2/c1-30-3-7-32(8-4-30)33-11-17-37(18-12-33)57-40-27-41(29-42(28-40)59-45(47,48)46(49,50)61(53,54)55)58-38-19-13-35(14-20-38)34-9-15-36(16-10-34)56-39-21-25-44(26-22-39)60(51,52)43-23-5-31(2)6-24-43/h3-29H,1-2H3,(H,53,54,55) |
| InChIKey | FUGJZKDYPCAFPH-UHFFFAOYSA-N |
| XLogP | 12.30 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.90 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|