C13H23NO — CID 140905940
(E)-6-[cyclobutyl(methyl)amino]-2,2-dimethylhex-4-en-3-one (PubChem CID 140905940) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (E)-6-[cyclobutyl(methyl)amino]-2,2-dimethylhex-4-en-3-one.
| Compound Name | (E)-6-[cyclobutyl(methyl)amino]-2,2-dimethylhex-4-en-3-one |
|---|---|
| PubChem CID | 140905940 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (E)-6-[cyclobutyl(methyl)amino]-2,2-dimethylhex-4-en-3-one |
| SMILES | CN(C/C=C/C(=O)C(C)(C)C)C1CCC1 |
| InChI | InChI=1S/C13H23NO/c1-13(2,3)12(15)9-6-10-14(4)11-7-5-8-11/h6,9,11H,5,7-8,10H2,1-4H3/b9-6+ |
| InChIKey | WCWMUHUCHUAIID-RMKNXTFCSA-N |
| XLogP | 2.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|