C15H23N4O2+ — CID 140907563
oxo-[4-[(1-propylpiperidin-4-yl)carbamoylamino]phenyl]azanium (PubChem CID 140907563) has the molecular formula C15H23N4O2+ and a molecular weight of 291.37 g/mol. Its IUPAC name is oxo-[4-[(1-propylpiperidin-4-yl)carbamoylamino]phenyl]azanium.
| Compound Name | oxo-[4-[(1-propylpiperidin-4-yl)carbamoylamino]phenyl]azanium |
|---|---|
| PubChem CID | 140907563 |
| Molecular Formula | C15H23N4O2+ |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | oxo-[4-[(1-propylpiperidin-4-yl)carbamoylamino]phenyl]azanium |
| SMILES | CCCN1CCC(NC(=O)Nc2ccc([NH+]=O)cc2)CC1 |
| InChI | InChI=1S/C15H22N4O2/c1-2-9-19-10-7-13(8-11-19)17-15(20)16-12-3-5-14(18-21)6-4-12/h3-6,13H,2,7-11H2,1H3,(H2,16,17,20)/p+1 |
| InChIKey | RULIOEGSNFRKHM-UHFFFAOYSA-O |
| XLogP | 1.16 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |