C19H29NO — CID 140910140
2-[(9R)-9-(3-methylbutyl)-6-oxaspiro[4.5]decan-9-yl]pyridine (PubChem CID 140910140) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 2-[(9R)-9-(3-methylbutyl)-6-oxaspiro[4.5]decan-9-yl]pyridine.
| Compound Name | 2-[(9R)-9-(3-methylbutyl)-6-oxaspiro[4.5]decan-9-yl]pyridine |
|---|---|
| PubChem CID | 140910140 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 2-[(9R)-9-(3-methylbutyl)-6-oxaspiro[4.5]decan-9-yl]pyridine |
| SMILES | CC(C)CC[C@@]1(c2ccccn2)CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C19H29NO/c1-16(2)8-11-18(17-7-3-6-13-20-17)12-14-21-19(15-18)9-4-5-10-19/h3,6-7,13,16H,4-5,8-12,14-15H2,1-2H3/t18-/m1/s1 |
| InChIKey | WASXCPYQQLGIJY-GOSISDBHSA-N |
| XLogP | 4.88 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |