C16H29N7O18S4 — CID 140912128
[[3-amino-4-[[1-[[1,4-dioxo-1,4-bis(sulfomethylamino)butan-2-yl]amino]-1,4-dioxo-4-(sulfomethylamino)butan-2-yl]amino]-4-oxobutanoyl]amino]methanesulfonic acid (PubChem CID 140912128) has the molecular formula C16H29N7O18S4 and a molecular weight of 735.71 g/mol. Its IUPAC name is [[3-amino-4-[[1-[[1,4-dioxo-1,4-bis(sulfomethylamino)butan-2-yl]amino]-1,4-dioxo-4-(sulfomethylamino)butan-2-yl]amino]-4-oxobutanoyl]amino]methanesulfonic acid.
| Compound Name | [[3-amino-4-[[1-[[1,4-dioxo-1,4-bis(sulfomethylamino)butan-2-yl]amino]-1,4-dioxo-4-(sulfomethylamino)butan-2-yl]amino]-4-oxobutanoyl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 140912128 |
| Molecular Formula | C16H29N7O18S4 |
| Molecular Weight | 735.71 g/mol |
| Exact Mass | 735.05 |
| IUPAC Name | [[3-amino-4-[[1-[[1,4-dioxo-1,4-bis(sulfomethylamino)butan-2-yl]amino]-1,4-dioxo-4-(sulfomethylamino)butan-2-yl]amino]-4-oxobutanoyl]amino]methanesulfonic acid |
| SMILES | NC(CC(=O)NCS(=O)(=O)O)C(=O)NC(CC(=O)NCS(=O)(=O)O)C(=O)NC(CC(=O)NCS(=O)(=O)O)C(=O)NCS(=O)(=O)O |
| InChI | InChI=1S/C16H29N7O18S4/c17-8(1-11(24)18-4-42(30,31)32)14(27)22-10(3-13(26)20-6-44(36,37)38)16(29)23-9(15(28)21-7-45(39,40)41)2-12(25)19-5-43(33,34)35/h8-10H,1-7,17H2,(H,18,24)(H,19,25)(H,20,26)(H,21,28)(H,22,27)(H,23,29)(H,30,31,32)(H,33,34,35)(H,36,37,38)(H,39,40,41) |
| InChIKey | IKHIZDSOSIJNJM-UHFFFAOYSA-N |
| XLogP | -7.70 |
| TPSA | 418.10 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.71 |
| LogP ≤ 5 | -7.70 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|