C48H46N4 — CID 140914156
1-[9,10-dipyridin-2-yl-6-(2,2,3,3-tetramethylindol-1-yl)anthracen-2-yl]-2,2,3,3-tetramethylindole (PubChem CID 140914156) has the molecular formula C48H46N4 and a molecular weight of 678.92 g/mol. Its IUPAC name is 1-[9,10-dipyridin-2-yl-6-(2,2,3,3-tetramethylindol-1-yl)anthracen-2-yl]-2,2,3,3-tetramethylindole.
| Compound Name | 1-[9,10-dipyridin-2-yl-6-(2,2,3,3-tetramethylindol-1-yl)anthracen-2-yl]-2,2,3,3-tetramethylindole |
|---|---|
| PubChem CID | 140914156 |
| Molecular Formula | C48H46N4 |
| Molecular Weight | 678.92 g/mol |
| Exact Mass | 678.37 |
| IUPAC Name | 1-[9,10-dipyridin-2-yl-6-(2,2,3,3-tetramethylindol-1-yl)anthracen-2-yl]-2,2,3,3-tetramethylindole |
| SMILES | CC1(C)c2ccccc2N(c2ccc3c(-c4ccccn4)c4cc(N5c6ccccc6C(C)(C)C5(C)C)ccc4c(-c4ccccn4)c3c2)C1(C)C |
| InChI | InChI=1S/C48H46N4/c1-45(2)37-17-9-11-21-41(37)51(47(45,5)6)31-23-25-33-35(29-31)43(39-19-13-15-27-49-39)34-26-24-32(30-36(34)44(33)40-20-14-16-28-50-40)52-42-22-12-10-18-38(42)46(3,4)48(52,7)8/h9-30H,1-8H3 |
| InChIKey | YCXBBHIEYHFZFY-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.92 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|