C18H20ClN — CID 166015344
1-(3-chlorophenyl)-2,2,3,3-tetramethylindole (PubChem CID 166015344) has the molecular formula C18H20ClN and a molecular weight of 285.82 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2,2,3,3-tetramethylindole.
| Compound Name | 1-(3-chlorophenyl)-2,2,3,3-tetramethylindole |
|---|---|
| PubChem CID | 166015344 |
| Molecular Formula | C18H20ClN |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-(3-chlorophenyl)-2,2,3,3-tetramethylindole |
| SMILES | CC1(C)c2ccccc2N(c2cccc(Cl)c2)C1(C)C |
| InChI | InChI=1S/C18H20ClN/c1-17(2)15-10-5-6-11-16(15)20(18(17,3)4)14-9-7-8-13(19)12-14/h5-12H,1-4H3 |
| InChIKey | YJAASGLPJJXZIK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |