C16H12ClN3O2 — CID 10403335
1-(3-chlorophenyl)-8b-hydroxy-3a-methylindeno[1,2-d]triazol-4-one (PubChem CID 10403335) has the molecular formula C16H12ClN3O2 and a molecular weight of 313.74 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-8b-hydroxy-3a-methylindeno[1,2-d]triazol-4-one.
| Compound Name | 1-(3-chlorophenyl)-8b-hydroxy-3a-methylindeno[1,2-d]triazol-4-one |
|---|---|
| PubChem CID | 10403335 |
| Molecular Formula | C16H12ClN3O2 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 1-(3-chlorophenyl)-8b-hydroxy-3a-methylindeno[1,2-d]triazol-4-one |
| SMILES | CC12N=NN(c3cccc(Cl)c3)C1(O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H12ClN3O2/c1-15-14(21)12-7-2-3-8-13(12)16(15,22)20(19-18-15)11-6-4-5-10(17)9-11/h2-9,22H,1H3 |
| InChIKey | WCWCJLIDAWNZLG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |