C13H11N3O4 — CID 140915199
4-amino-5,6,7-trideuterio-2-[(3S)-3,4,4,5,5-pentadeuterio-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione (PubChem CID 140915199) has the molecular formula C13H11N3O4 and a molecular weight of 281.30 g/mol. Its IUPAC name is 4-amino-5,6,7-trideuterio-2-[(3S)-3,4,4,5,5-pentadeuterio-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione.
| Compound Name | 4-amino-5,6,7-trideuterio-2-[(3S)-3,4,4,5,5-pentadeuterio-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 140915199 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-amino-5,6,7-trideuterio-2-[(3S)-3,4,4,5,5-pentadeuterio-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione |
| SMILES | [2H]c1c([2H])c(N)c2c(c1[2H])C(=O)N([C@]1([2H])C(=O)NC(=O)C([2H])([2H])C1([2H])[2H])C2=O |
| InChI | InChI=1S/C13H11N3O4/c14-7-3-1-2-6-10(7)13(20)16(12(6)19)8-4-5-9(17)15-11(8)18/h1-3,8H,4-5,14H2,(H,15,17,18)/t8-/m0/s1/i1D,2D,3D,4D2,5D2,8D |
| InChIKey | UVSMNLNDYGZFPF-VIIHBXRESA-N |
| XLogP | -0.33 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|