C13H12FN3O3 — CID 140817631
(3S)-3-(7-amino-4,6-dideuterio-5-fluoro-3-oxo-1H-isoindol-2-yl)-3,4,4,5,5-pentadeuteriopiperidine-2,6-dione (PubChem CID 140817631) has the molecular formula C13H12FN3O3 and a molecular weight of 284.30 g/mol. Its IUPAC name is (3S)-3-(7-amino-4,6-dideuterio-5-fluoro-3-oxo-1H-isoindol-2-yl)-3,4,4,5,5-pentadeuteriopiperidine-2,6-dione.
| Compound Name | (3S)-3-(7-amino-4,6-dideuterio-5-fluoro-3-oxo-1H-isoindol-2-yl)-3,4,4,5,5-pentadeuteriopiperidine-2,6-dione |
|---|---|
| PubChem CID | 140817631 |
| Molecular Formula | C13H12FN3O3 |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (3S)-3-(7-amino-4,6-dideuterio-5-fluoro-3-oxo-1H-isoindol-2-yl)-3,4,4,5,5-pentadeuteriopiperidine-2,6-dione |
| SMILES | [2H]c1c(N)c2c(c([2H])c1F)C(=O)N([C@]1([2H])C(=O)NC(=O)C([2H])([2H])C1([2H])[2H])C2 |
| InChI | InChI=1S/C13H12FN3O3/c14-6-3-7-8(9(15)4-6)5-17(13(7)20)10-1-2-11(18)16-12(10)19/h3-4,10H,1-2,5,15H2,(H,16,18,19)/t10-/m0/s1/i1D2,2D2,3D,4D,10D |
| InChIKey | ZLSXUIDRXBLOLG-PYZAXEDZSA-N |
| XLogP | 0.17 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|