C23H25F6O4S+ — CID 140915984
tert-butyl [1,1,1,3,3,3-hexafluoro-2-[[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]oxymethyl]propan-2-yl] carbonate (PubChem CID 140915984) has the molecular formula C23H25F6O4S+ and a molecular weight of 511.50 g/mol. Its IUPAC name is tert-butyl [1,1,1,3,3,3-hexafluoro-2-[[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]oxymethyl]propan-2-yl] carbonate.
| Compound Name | tert-butyl [1,1,1,3,3,3-hexafluoro-2-[[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]oxymethyl]propan-2-yl] carbonate |
|---|---|
| PubChem CID | 140915984 |
| Molecular Formula | C23H25F6O4S+ |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | tert-butyl [1,1,1,3,3,3-hexafluoro-2-[[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]oxymethyl]propan-2-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)OC(COc1ccc([S+]2CCCC2)c2ccccc12)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H25F6O4S/c1-20(2,3)32-19(30)33-21(22(24,25)26,23(27,28)29)14-31-17-10-11-18(34-12-6-7-13-34)16-9-5-4-8-15(16)17/h4-5,8-11H,6-7,12-14H2,1-3H3/q+1 |
| InChIKey | UMIGLSKIHNSDLL-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|