C20H21F6O3S+ — CID 140916000
1-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]naphthalen-1-yl]thiolan-1-ium (PubChem CID 140916000) has the molecular formula C20H21F6O3S+ and a molecular weight of 455.44 g/mol. Its IUPAC name is 1-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]naphthalen-1-yl]thiolan-1-ium.
| Compound Name | 1-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]naphthalen-1-yl]thiolan-1-ium |
|---|---|
| PubChem CID | 140916000 |
| Molecular Formula | C20H21F6O3S+ |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 1-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]naphthalen-1-yl]thiolan-1-ium |
| SMILES | COCOC(COc1ccc([S+]2CCCC2)c2ccccc12)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H21F6O3S/c1-27-13-29-18(19(21,22)23,20(24,25)26)12-28-16-8-9-17(30-10-4-5-11-30)15-7-3-2-6-14(15)16/h2-3,6-9H,4-5,10-13H2,1H3/q+1 |
| InChIKey | VAERMZMNDACDNF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|