C14H25N2O2+ — CID 140917660
(2R)-1-(4-methylcyclohexyl)oxy-3-(2-methyl-1H-imidazol-3-ium-3-yl)propan-2-ol (PubChem CID 140917660) has the molecular formula C14H25N2O2+ and a molecular weight of 253.37 g/mol. Its IUPAC name is (2R)-1-(4-methylcyclohexyl)oxy-3-(2-methyl-1H-imidazol-3-ium-3-yl)propan-2-ol.
| Compound Name | (2R)-1-(4-methylcyclohexyl)oxy-3-(2-methyl-1H-imidazol-3-ium-3-yl)propan-2-ol |
|---|---|
| PubChem CID | 140917660 |
| Molecular Formula | C14H25N2O2+ |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | (2R)-1-(4-methylcyclohexyl)oxy-3-(2-methyl-1H-imidazol-3-ium-3-yl)propan-2-ol |
| SMILES | Cc1[nH]cc[n+]1C[C@@H](O)COC1CCC(C)CC1 |
| InChI | InChI=1S/C14H24N2O2/c1-11-3-5-14(6-4-11)18-10-13(17)9-16-8-7-15-12(16)2/h7-8,11,13-14,17H,3-6,9-10H2,1-2H3/p+1/t11?,13-,14?/m1/s1 |
| InChIKey | DZHPCQCNGUWHGD-HRDQMINSSA-O |
| XLogP | 1.57 |
| TPSA | 49.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|