C12H21F2N3S — CID 140917731
3-[(4,6-difluoro-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzothiazol-2-ylidene)amino]-N,N-dimethylpropan-1-amine (PubChem CID 140917731) has the molecular formula C12H21F2N3S and a molecular weight of 277.38 g/mol. Its IUPAC name is 3-[(4,6-difluoro-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzothiazol-2-ylidene)amino]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(4,6-difluoro-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzothiazol-2-ylidene)amino]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 140917731 |
| Molecular Formula | C12H21F2N3S |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 3-[(4,6-difluoro-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzothiazol-2-ylidene)amino]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCC/N=C1/NC2C(F)CC(F)CC2S1 |
| InChI | InChI=1S/C12H21F2N3S/c1-17(2)5-3-4-15-12-16-11-9(14)6-8(13)7-10(11)18-12/h8-11H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | NSJNCZWZWAYKQB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|