C9H16N2S — CID 166754611
(7aS)-N,3-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-imine (PubChem CID 166754611) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is (7aS)-N,3-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-imine.
| Compound Name | (7aS)-N,3-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 166754611 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (7aS)-N,3-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-imine |
| SMILES | C/N=C1\S[C@H]2CCCCC2N1C |
| InChI | InChI=1S/C9H16N2S/c1-10-9-11(2)7-5-3-4-6-8(7)12-9/h7-8H,3-6H2,1-2H3/b10-9-/t7?,8-/m0/s1 |
| InChIKey | QKEFMWJPSXWWRA-KGYWQRDCSA-N |
| XLogP | 1.96 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|