C15H28N2S — CID 138692868
(8aS)-N-octyl-1,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,4-a]pyridin-3-imine (PubChem CID 138692868) has the molecular formula C15H28N2S and a molecular weight of 268.47 g/mol. Its IUPAC name is (8aS)-N-octyl-1,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,4-a]pyridin-3-imine.
| Compound Name | (8aS)-N-octyl-1,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,4-a]pyridin-3-imine |
|---|---|
| PubChem CID | 138692868 |
| Molecular Formula | C15H28N2S |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (8aS)-N-octyl-1,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,4-a]pyridin-3-imine |
| SMILES | CCCCCCCC/N=C1\SC[C@@H]2CCCCN12 |
| InChI | InChI=1S/C15H28N2S/c1-2-3-4-5-6-8-11-16-15-17-12-9-7-10-14(17)13-18-15/h14H,2-13H2,1H3/b16-15-/t14-/m0/s1 |
| InChIKey | KEUVDDKKZZYOEU-DQHOPXMZSA-N |
| XLogP | 4.30 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|