C15H28N2S — CID 167242586
N,3-di(propan-2-yl)-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]thiazol-2-imine (PubChem CID 167242586) has the molecular formula C15H28N2S and a molecular weight of 268.47 g/mol. Its IUPAC name is N,3-di(propan-2-yl)-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]thiazol-2-imine.
| Compound Name | N,3-di(propan-2-yl)-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]thiazol-2-imine |
|---|---|
| PubChem CID | 167242586 |
| Molecular Formula | C15H28N2S |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | N,3-di(propan-2-yl)-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]thiazol-2-imine |
| SMILES | CC(C)/N=C1\SC2CCCCCCC2N1C(C)C |
| InChI | InChI=1S/C15H28N2S/c1-11(2)16-15-17(12(3)4)13-9-7-5-6-8-10-14(13)18-15/h11-14H,5-10H2,1-4H3/b16-15- |
| InChIKey | KOZPSYNJJJXVIR-NXVVXOECSA-N |
| XLogP | 4.30 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|