C11H20N2S — CID 167109729
(9aS)-N,3-dimethyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]thiazol-2-imine (PubChem CID 167109729) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is (9aS)-N,3-dimethyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]thiazol-2-imine.
| Compound Name | (9aS)-N,3-dimethyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]thiazol-2-imine |
|---|---|
| PubChem CID | 167109729 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (9aS)-N,3-dimethyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]thiazol-2-imine |
| SMILES | C/N=C1\S[C@H]2CCCCCCC2N1C |
| InChI | InChI=1S/C11H20N2S/c1-12-11-13(2)9-7-5-3-4-6-8-10(9)14-11/h9-10H,3-8H2,1-2H3/b12-11-/t9?,10-/m0/s1 |
| InChIKey | DBYKUDCGHPHRSF-MHXZTGGQSA-N |
| XLogP | 2.74 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|