C10H18N2S — CID 147739956
N,3-dimethyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,3]thiazol-2-imine (PubChem CID 147739956) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is N,3-dimethyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,3]thiazol-2-imine.
| Compound Name | N,3-dimethyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,3]thiazol-2-imine |
|---|---|
| PubChem CID | 147739956 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | N,3-dimethyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,3]thiazol-2-imine |
| SMILES | C/N=C1\SC2CCCCCC2N1C |
| InChI | InChI=1S/C10H18N2S/c1-11-10-12(2)8-6-4-3-5-7-9(8)13-10/h8-9H,3-7H2,1-2H3/b11-10- |
| InChIKey | MDCJXSDALYOSTQ-KHPPLWFESA-N |
| XLogP | 2.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|