C14H26N2S — CID 166733216
6-methyl-N,3-di(propan-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-imine (PubChem CID 166733216) has the molecular formula C14H26N2S and a molecular weight of 254.44 g/mol. Its IUPAC name is 6-methyl-N,3-di(propan-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-imine.
| Compound Name | 6-methyl-N,3-di(propan-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 166733216 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 6-methyl-N,3-di(propan-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-imine |
| SMILES | CC1CCC2C(C1)S/C(=N\C(C)C)N2C(C)C |
| InChI | InChI=1S/C14H26N2S/c1-9(2)15-14-16(10(3)4)12-7-6-11(5)8-13(12)17-14/h9-13H,6-8H2,1-5H3/b15-14- |
| InChIKey | NMAGZHVXRHUVBE-PFONDFGASA-N |
| XLogP | 3.77 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|