C15H17N3 — CID 140917845
8-methyl-7-[(2S)-2-methyl-3-(trideuteriomethyl)-2H-imidazol-1-yl]isoquinoline (PubChem CID 140917845) has the molecular formula C15H17N3 and a molecular weight of 242.34 g/mol. Its IUPAC name is 8-methyl-7-[(2S)-2-methyl-3-(trideuteriomethyl)-2H-imidazol-1-yl]isoquinoline.
| Compound Name | 8-methyl-7-[(2S)-2-methyl-3-(trideuteriomethyl)-2H-imidazol-1-yl]isoquinoline |
|---|---|
| PubChem CID | 140917845 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 8-methyl-7-[(2S)-2-methyl-3-(trideuteriomethyl)-2H-imidazol-1-yl]isoquinoline |
| SMILES | [2H]C([2H])([2H])N1C=CN(c2ccc3ccncc3c2C)[C@H]1C |
| InChI | InChI=1S/C15H17N3/c1-11-14-10-16-7-6-13(14)4-5-15(11)18-9-8-17(3)12(18)2/h4-10,12H,1-3H3/t12-/m0/s1/i3D3 |
| InChIKey | PNTSXSWKVYCRPT-OGWVHELISA-N |
| XLogP | 3.11 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |