C34H36B2N2 — CID 153276187
(2S)-1-[5,10-bis(2,6-dimethylphenyl)-1-methylboranthren-2-yl]-2,3-dimethyl-2H-imidazole (PubChem CID 153276187) has the molecular formula C34H36B2N2 and a molecular weight of 494.30 g/mol. Its IUPAC name is (2S)-1-[5,10-bis(2,6-dimethylphenyl)-1-methylboranthren-2-yl]-2,3-dimethyl-2H-imidazole.
| Compound Name | (2S)-1-[5,10-bis(2,6-dimethylphenyl)-1-methylboranthren-2-yl]-2,3-dimethyl-2H-imidazole |
|---|---|
| PubChem CID | 153276187 |
| Molecular Formula | C34H36B2N2 |
| Molecular Weight | 494.30 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | (2S)-1-[5,10-bis(2,6-dimethylphenyl)-1-methylboranthren-2-yl]-2,3-dimethyl-2H-imidazole |
| SMILES | Cc1cccc(C)c1B1c2ccccc2B(c2c(C)cccc2C)c2c1ccc(N1C=CN(C)[C@@H]1C)c2C |
| InChI | InChI=1S/C34H36B2N2/c1-22-12-10-13-23(2)32(22)35-28-16-8-9-17-29(28)36(33-24(3)14-11-15-25(33)4)34-26(5)31(19-18-30(34)35)38-21-20-37(7)27(38)6/h8-21,27H,1-7H3/t27-/m0/s1 |
| InChIKey | UXVBWNVLFZKLRG-MHZLTWQESA-N |
| XLogP | 3.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|