C19H19N3 — CID 140917852
3-[(2S)-2,3-dimethyl-2H-benzimidazol-1-yl]-4-methylquinoline (PubChem CID 140917852) has the molecular formula C19H19N3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-[(2S)-2,3-dimethyl-2H-benzimidazol-1-yl]-4-methylquinoline.
| Compound Name | 3-[(2S)-2,3-dimethyl-2H-benzimidazol-1-yl]-4-methylquinoline |
|---|---|
| PubChem CID | 140917852 |
| Molecular Formula | C19H19N3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 3-[(2S)-2,3-dimethyl-2H-benzimidazol-1-yl]-4-methylquinoline |
| SMILES | Cc1c(N2c3ccccc3N(C)[C@@H]2C)cnc2ccccc12 |
| InChI | InChI=1S/C19H19N3/c1-13-15-8-4-5-9-16(15)20-12-19(13)22-14(2)21(3)17-10-6-7-11-18(17)22/h4-12,14H,1-3H3/t14-/m0/s1 |
| InChIKey | RMBQLMWZIZHANB-AWEZNQCLSA-N |
| XLogP | 4.48 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |