C44H25N3S — CID 140918007
22-[4-(2,3,4,5,6-pentadeuteriophenyl)phenanthro[9,10-d]pyrimidin-2-yl]-3-thia-22-azahexacyclo[11.11.0.02,10.04,9.015,23.016,21]tetracosa-1(24),2(10),4,6,8,11,13,15(23),16,18,20-undecaene (PubChem CID 140918007) has the molecular formula C44H25N3S and a molecular weight of 632.80 g/mol. Its IUPAC name is 22-[4-(2,3,4,5,6-pentadeuteriophenyl)phenanthro[9,10-d]pyrimidin-2-yl]-3-thia-22-azahexacyclo[11.11.0.02,10.04,9.015,23.016,21]tetracosa-1(24),2(10),4,6,8,11,13,15(23),16,18,20-undecaene.
| Compound Name | 22-[4-(2,3,4,5,6-pentadeuteriophenyl)phenanthro[9,10-d]pyrimidin-2-yl]-3-thia-22-azahexacyclo[11.11.0.02,10.04,9.015,23.016,21]tetracosa-1(24),2(10),4,6,8,11,13,15(23),16,18,20-undecaene |
|---|---|
| PubChem CID | 140918007 |
| Molecular Formula | C44H25N3S |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 632.21 |
| IUPAC Name | 22-[4-(2,3,4,5,6-pentadeuteriophenyl)phenanthro[9,10-d]pyrimidin-2-yl]-3-thia-22-azahexacyclo[11.11.0.02,10.04,9.015,23.016,21]tetracosa-1(24),2(10),4,6,8,11,13,15(23),16,18,20-undecaene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-n3c4ccccc4c4cc5ccc6c7ccccc7sc6c5cc43)nc3c4ccccc4c4ccccc4c23)c([2H])c1[2H] |
| InChI | InChI=1S/C44H25N3S/c1-2-12-26(13-3-1)41-40-32-18-6-4-14-28(32)29-15-5-7-19-33(29)42(40)46-44(45-41)47-37-20-10-8-16-30(37)36-24-27-22-23-34-31-17-9-11-21-39(31)48-43(34)35(27)25-38(36)47/h1-25H/i1D,2D,3D,12D,13D |
| InChIKey | RCOCPWGOVLCPNR-AYAICNHJSA-N |
| XLogP | 12.22 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|