C27H25N5O2 — CID 140922108
(4-aminophenyl)-[2-cyclopropyl-6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-benzimidazol-4-yl]-pyridin-2-ylmethanol (PubChem CID 140922108) has the molecular formula C27H25N5O2 and a molecular weight of 451.53 g/mol. Its IUPAC name is (4-aminophenyl)-[2-cyclopropyl-6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-benzimidazol-4-yl]-pyridin-2-ylmethanol.
| Compound Name | (4-aminophenyl)-[2-cyclopropyl-6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-benzimidazol-4-yl]-pyridin-2-ylmethanol |
|---|---|
| PubChem CID | 140922108 |
| Molecular Formula | C27H25N5O2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | (4-aminophenyl)-[2-cyclopropyl-6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-benzimidazol-4-yl]-pyridin-2-ylmethanol |
| SMILES | Cc1noc(C)c1-c1cc(C(O)(c2ccc(N)cc2)c2ccccn2)c2nc(C3CC3)[nH]c2c1 |
| InChI | InChI=1S/C27H25N5O2/c1-15-24(16(2)34-32-15)18-13-21(25-22(14-18)30-26(31-25)17-6-7-17)27(33,23-5-3-4-12-29-23)19-8-10-20(28)11-9-19/h3-5,8-14,17,33H,6-7,28H2,1-2H3,(H,30,31) |
| InChIKey | PSNMBPNXKNNHAW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|