C19H22N6O — CID 144744368
N-[2-cyclopropyl-6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-benzimidazol-4-yl]-N-ethanimidoylethanimidamide (PubChem CID 144744368) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is N-[2-cyclopropyl-6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-benzimidazol-4-yl]-N-ethanimidoylethanimidamide.
| Compound Name | N-[2-cyclopropyl-6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-benzimidazol-4-yl]-N-ethanimidoylethanimidamide |
|---|---|
| PubChem CID | 144744368 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | N-[2-cyclopropyl-6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-benzimidazol-4-yl]-N-ethanimidoylethanimidamide |
| SMILES | [H]/N=C(\C)N(/C(C)=N/[H])c1cc(-c2c(C)noc2C)cc2[nH]c(C3CC3)nc12 |
| InChI | InChI=1S/C19H22N6O/c1-9-17(10(2)26-24-9)14-7-15-18(23-19(22-15)13-5-6-13)16(8-14)25(11(3)20)12(4)21/h7-8,13,20-21H,5-6H2,1-4H3,(H,22,23)/b20-11+,21-12+ |
| InChIKey | CIEYINCBSNSLTM-HGEIODPWSA-N |
| XLogP | 4.51 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|