C49H33N3 — CID 140922336
9-[3-(2-isocyanophenyl)-5-(4-phenylquinolin-2-yl)phenyl]-14,14-dimethyl-9-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene (PubChem CID 140922336) has the molecular formula C49H33N3 and a molecular weight of 663.82 g/mol. Its IUPAC name is 9-[3-(2-isocyanophenyl)-5-(4-phenylquinolin-2-yl)phenyl]-14,14-dimethyl-9-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene.
| Compound Name | 9-[3-(2-isocyanophenyl)-5-(4-phenylquinolin-2-yl)phenyl]-14,14-dimethyl-9-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 140922336 |
| Molecular Formula | C49H33N3 |
| Molecular Weight | 663.82 g/mol |
| Exact Mass | 663.27 |
| IUPAC Name | 9-[3-(2-isocyanophenyl)-5-(4-phenylquinolin-2-yl)phenyl]-14,14-dimethyl-9-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
| SMILES | [C-]#[N+]c1ccccc1-c1cc(-c2cc(-c3ccccc3)c3ccccc3n2)cc(-n2c3ccccc3c3c4c(ccc32)C(C)(C)c2ccccc2-4)c1 |
| InChI | InChI=1S/C49H33N3/c1-49(2)40-21-11-7-19-37(40)47-41(49)25-26-46-48(47)38-20-10-14-24-45(38)52(46)34-28-32(35-17-8-12-22-42(35)50-3)27-33(29-34)44-30-39(31-15-5-4-6-16-31)36-18-9-13-23-43(36)51-44/h4-30H,1-2H3 |
| InChIKey | ODJCJNMPHJQGKX-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 22.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.82 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|