C14H12F4NP — CID 140922819
1,1-bis(3,5-difluorophenyl)-N-methyl-N-phosphanylmethanamine (PubChem CID 140922819) has the molecular formula C14H12F4NP and a molecular weight of 301.22 g/mol. Its IUPAC name is 1,1-bis(3,5-difluorophenyl)-N-methyl-N-phosphanylmethanamine.
| Compound Name | 1,1-bis(3,5-difluorophenyl)-N-methyl-N-phosphanylmethanamine |
|---|---|
| PubChem CID | 140922819 |
| Molecular Formula | C14H12F4NP |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 1,1-bis(3,5-difluorophenyl)-N-methyl-N-phosphanylmethanamine |
| SMILES | CN(P)C(c1cc(F)cc(F)c1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H12F4NP/c1-19(20)14(8-2-10(15)6-11(16)3-8)9-4-12(17)7-13(18)5-9/h2-7,14H,20H2,1H3 |
| InChIKey | GFAKUGUSHMYOSQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|