C11H15F2N — CID 97051252
N-[(1R)-1-(3,5-difluorophenyl)ethyl]propan-2-amine (PubChem CID 97051252) has the molecular formula C11H15F2N and a molecular weight of 199.24 g/mol. Its IUPAC name is N-[(1R)-1-(3,5-difluorophenyl)ethyl]propan-2-amine.
| Compound Name | N-[(1R)-1-(3,5-difluorophenyl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 97051252 |
| Molecular Formula | C11H15F2N |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | N-[(1R)-1-(3,5-difluorophenyl)ethyl]propan-2-amine |
| SMILES | CC(C)N[C@H](C)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H15F2N/c1-7(2)14-8(3)9-4-10(12)6-11(13)5-9/h4-8,14H,1-3H3/t8-/m1/s1 |
| InChIKey | AFXCUDANHGVZNH-MRVPVSSYSA-N |
| XLogP | 3.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |