C14H21F2N — CID 134331308
N-[(1S)-1-(3,5-difluorophenyl)ethyl]-3-methylpentan-3-amine (PubChem CID 134331308) has the molecular formula C14H21F2N and a molecular weight of 241.32 g/mol. Its IUPAC name is N-[(1S)-1-(3,5-difluorophenyl)ethyl]-3-methylpentan-3-amine.
| Compound Name | N-[(1S)-1-(3,5-difluorophenyl)ethyl]-3-methylpentan-3-amine |
|---|---|
| PubChem CID | 134331308 |
| Molecular Formula | C14H21F2N |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N-[(1S)-1-(3,5-difluorophenyl)ethyl]-3-methylpentan-3-amine |
| SMILES | CCC(C)(CC)N[C@@H](C)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H21F2N/c1-5-14(4,6-2)17-10(3)11-7-12(15)9-13(16)8-11/h7-10,17H,5-6H2,1-4H3/t10-/m0/s1 |
| InChIKey | MDRJUNCTSOUKTN-JTQLQIEISA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |