C13H18F2 — CID 58063354
1-(2,2-dimethylpentan-3-yl)-3,5-difluorobenzene (PubChem CID 58063354) has the molecular formula C13H18F2 and a molecular weight of 212.28 g/mol. Its IUPAC name is 1-(2,2-dimethylpentan-3-yl)-3,5-difluorobenzene.
| Compound Name | 1-(2,2-dimethylpentan-3-yl)-3,5-difluorobenzene |
|---|---|
| PubChem CID | 58063354 |
| Molecular Formula | C13H18F2 |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 1-(2,2-dimethylpentan-3-yl)-3,5-difluorobenzene |
| SMILES | CCC(c1cc(F)cc(F)c1)C(C)(C)C |
| InChI | InChI=1S/C13H18F2/c1-5-12(13(2,3)4)9-6-10(14)8-11(15)7-9/h6-8,12H,5H2,1-4H3 |
| InChIKey | STWMZTZNYDRBNA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |