C7H12BN3O3 — CID 140926186
N-[1-formyloxy-2-(1H-imidazol-5-yl)ethyl]-methylboronamidic acid (PubChem CID 140926186) has the molecular formula C7H12BN3O3 and a molecular weight of 197.00 g/mol. Its IUPAC name is N-[1-formyloxy-2-(1H-imidazol-5-yl)ethyl]-methylboronamidic acid.
| Compound Name | N-[1-formyloxy-2-(1H-imidazol-5-yl)ethyl]-methylboronamidic acid |
|---|---|
| PubChem CID | 140926186 |
| Molecular Formula | C7H12BN3O3 |
| Molecular Weight | 197.00 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | N-[1-formyloxy-2-(1H-imidazol-5-yl)ethyl]-methylboronamidic acid |
| SMILES | CB(O)NC(Cc1cnc[nH]1)OC=O |
| InChI | InChI=1S/C7H12BN3O3/c1-8(13)11-7(14-5-12)2-6-3-9-4-10-6/h3-5,7,11,13H,2H2,1H3,(H,9,10) |
| InChIKey | JTSWPWBYRIAZCG-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.00 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|