C12H28N5+ — CID 140927163
[dimethylamino-[(N,N'-dipropylcarbamimidoyl)amino]methylidene]-dimethylazanium (PubChem CID 140927163) has the molecular formula C12H28N5+ and a molecular weight of 242.39 g/mol. Its IUPAC name is [dimethylamino-[(N,N'-dipropylcarbamimidoyl)amino]methylidene]-dimethylazanium.
| Compound Name | [dimethylamino-[(N,N'-dipropylcarbamimidoyl)amino]methylidene]-dimethylazanium |
|---|---|
| PubChem CID | 140927163 |
| Molecular Formula | C12H28N5+ |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.23 |
| IUPAC Name | [dimethylamino-[(N,N'-dipropylcarbamimidoyl)amino]methylidene]-dimethylazanium |
| SMILES | CCC/N=C(\NCCC)NC(N(C)C)=[N+](C)C |
| InChI | InChI=1S/C12H27N5/c1-7-9-13-11(14-10-8-2)15-12(16(3)4)17(5)6/h7-10H2,1-6H3,(H,13,14)/p+1 |
| InChIKey | IOQYCCCGJWFGAS-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 42.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|