C31H31NO — CID 140927762
1-[3-methyl-4-[2-methyl-4-(N-phenylanilino)phenyl]phenyl]pentan-1-one (PubChem CID 140927762) has the molecular formula C31H31NO and a molecular weight of 433.60 g/mol. Its IUPAC name is 1-[3-methyl-4-[2-methyl-4-(N-phenylanilino)phenyl]phenyl]pentan-1-one.
| Compound Name | 1-[3-methyl-4-[2-methyl-4-(N-phenylanilino)phenyl]phenyl]pentan-1-one |
|---|---|
| PubChem CID | 140927762 |
| Molecular Formula | C31H31NO |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 1-[3-methyl-4-[2-methyl-4-(N-phenylanilino)phenyl]phenyl]pentan-1-one |
| SMILES | CCCCC(=O)c1ccc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2C)c(C)c1 |
| InChI | InChI=1S/C31H31NO/c1-4-5-16-31(33)25-17-19-29(23(2)21-25)30-20-18-28(22-24(30)3)32(26-12-8-6-9-13-26)27-14-10-7-11-15-27/h6-15,17-22H,4-5,16H2,1-3H3 |
| InChIKey | WHWFFQUOCHWSDP-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |