C22H19N3O5S — CID 140927841
4-[2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]sulfonylaniline (PubChem CID 140927841) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is 4-[2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]sulfonylaniline.
| Compound Name | 4-[2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]sulfonylaniline |
|---|---|
| PubChem CID | 140927841 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 4-[2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]sulfonylaniline |
| SMILES | COc1ccc(-c2noc(-c3ccccc3S(=O)(=O)c3ccc(N)cc3)n2)cc1OC |
| InChI | InChI=1S/C22H19N3O5S/c1-28-18-12-7-14(13-19(18)29-2)21-24-22(30-25-21)17-5-3-4-6-20(17)31(26,27)16-10-8-15(23)9-11-16/h3-13H,23H2,1-2H3 |
| InChIKey | OBAWIXXUJIPOQM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|