C22H24BrN5O — CID 140928931
6-bromo-3-(4-ethoxybut-1-en-2-yl)-N-[2-(1H-indol-3-yl)ethyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 140928931) has the molecular formula C22H24BrN5O and a molecular weight of 454.37 g/mol. Its IUPAC name is 6-bromo-3-(4-ethoxybut-1-en-2-yl)-N-[2-(1H-indol-3-yl)ethyl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-bromo-3-(4-ethoxybut-1-en-2-yl)-N-[2-(1H-indol-3-yl)ethyl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 140928931 |
| Molecular Formula | C22H24BrN5O |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 6-bromo-3-(4-ethoxybut-1-en-2-yl)-N-[2-(1H-indol-3-yl)ethyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | C=C(CCOCC)c1cnc2c(NCCc3c[nH]c4ccccc34)nc(Br)cn12 |
| InChI | InChI=1S/C22H24BrN5O/c1-3-29-11-9-15(2)19-13-26-22-21(27-20(23)14-28(19)22)24-10-8-16-12-25-18-7-5-4-6-17(16)18/h4-7,12-14,25H,2-3,8-11H2,1H3,(H,24,27) |
| InChIKey | CYPOERGMHRDJRE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|