C21H18N+ — CID 140929870
4-(3,5-dimethylphenyl)benzo[f]isoquinolin-3-ium (PubChem CID 140929870) has the molecular formula C21H18N+ and a molecular weight of 284.38 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)benzo[f]isoquinolin-3-ium.
| Compound Name | 4-(3,5-dimethylphenyl)benzo[f]isoquinolin-3-ium |
|---|---|
| PubChem CID | 140929870 |
| Molecular Formula | C21H18N+ |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 4-(3,5-dimethylphenyl)benzo[f]isoquinolin-3-ium |
| SMILES | Cc1cc(C)cc(-c2[nH+]ccc3c2ccc2ccccc23)c1 |
| InChI | InChI=1S/C21H17N/c1-14-11-15(2)13-17(12-14)21-20-8-7-16-5-3-4-6-18(16)19(20)9-10-22-21/h3-13H,1-2H3/p+1 |
| InChIKey | DSWWEWKUEFLHLU-UHFFFAOYSA-O |
| XLogP | 5.09 |
| TPSA | 14.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|