C28H26N+ — CID 123993981
8-methyl-1-[4-(2-methylpropyl)phenyl]naphtho[2,1-f]isoquinolin-2-ium (PubChem CID 123993981) has the molecular formula C28H26N+ and a molecular weight of 376.52 g/mol. Its IUPAC name is 8-methyl-1-[4-(2-methylpropyl)phenyl]naphtho[2,1-f]isoquinolin-2-ium.
| Compound Name | 8-methyl-1-[4-(2-methylpropyl)phenyl]naphtho[2,1-f]isoquinolin-2-ium |
|---|---|
| PubChem CID | 123993981 |
| Molecular Formula | C28H26N+ |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 8-methyl-1-[4-(2-methylpropyl)phenyl]naphtho[2,1-f]isoquinolin-2-ium |
| SMILES | Cc1ccc2c(ccc3c4cc[nH+]c(-c5ccc(CC(C)C)cc5)c4ccc23)c1 |
| InChI | InChI=1S/C28H25N/c1-18(2)16-20-5-7-21(8-6-20)28-27-13-12-24-23-10-4-19(3)17-22(23)9-11-25(24)26(27)14-15-29-28/h4-15,17-18H,16H2,1-3H3/p+1 |
| InChIKey | GUKZERIZVUMHMN-UHFFFAOYSA-O |
| XLogP | 7.13 |
| TPSA | 14.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|