C21H18N4OS — CID 140930907
11-(5-isocyanothiophen-2-yl)-8,8-dimethyl-6,7,9,11-tetrahydro-3H-imidazo[4,5-a]acridin-10-one (PubChem CID 140930907) has the molecular formula C21H18N4OS and a molecular weight of 374.47 g/mol. Its IUPAC name is 11-(5-isocyanothiophen-2-yl)-8,8-dimethyl-6,7,9,11-tetrahydro-3H-imidazo[4,5-a]acridin-10-one.
| Compound Name | 11-(5-isocyanothiophen-2-yl)-8,8-dimethyl-6,7,9,11-tetrahydro-3H-imidazo[4,5-a]acridin-10-one |
|---|---|
| PubChem CID | 140930907 |
| Molecular Formula | C21H18N4OS |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 11-(5-isocyanothiophen-2-yl)-8,8-dimethyl-6,7,9,11-tetrahydro-3H-imidazo[4,5-a]acridin-10-one |
| SMILES | [C-]#[N+]c1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3ccc4[nH]cnc4c32)s1 |
| InChI | InChI=1S/C21H18N4OS/c1-21(2)8-13-17(14(26)9-21)19(15-6-7-16(22-3)27-15)18-11(25-13)4-5-12-20(18)24-10-23-12/h4-7,10,19,25H,8-9H2,1-2H3,(H,23,24) |
| InChIKey | VOAHQAGQWUJSCI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|