C27H25N3OS — CID 140930941
1,8,8-trimethyl-11-(5-phenylthiophen-2-yl)-6,7,9,11-tetrahydropyrazolo[5,4-a]acridin-10-one (PubChem CID 140930941) has the molecular formula C27H25N3OS and a molecular weight of 439.58 g/mol. Its IUPAC name is 1,8,8-trimethyl-11-(5-phenylthiophen-2-yl)-6,7,9,11-tetrahydropyrazolo[5,4-a]acridin-10-one.
| Compound Name | 1,8,8-trimethyl-11-(5-phenylthiophen-2-yl)-6,7,9,11-tetrahydropyrazolo[5,4-a]acridin-10-one |
|---|---|
| PubChem CID | 140930941 |
| Molecular Formula | C27H25N3OS |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 1,8,8-trimethyl-11-(5-phenylthiophen-2-yl)-6,7,9,11-tetrahydropyrazolo[5,4-a]acridin-10-one |
| SMILES | Cn1ncc2ccc3c(c21)C(c1ccc(-c2ccccc2)s1)C1=C(CC(C)(C)CC1=O)N3 |
| InChI | InChI=1S/C27H25N3OS/c1-27(2)13-19-23(20(31)14-27)25(22-12-11-21(32-22)16-7-5-4-6-8-16)24-18(29-19)10-9-17-15-28-30(3)26(17)24/h4-12,15,25,29H,13-14H2,1-3H3 |
| InChIKey | POGSBZYTHMSGAD-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |