C27H25NOS — CID 145288336
12-(1-benzothiophen-2-yl)-9,9-dimethyl-3,4,7,8,10,12-hexahydrobenzo[a]acridin-11-one (PubChem CID 145288336) has the molecular formula C27H25NOS and a molecular weight of 411.57 g/mol. Its IUPAC name is 12-(1-benzothiophen-2-yl)-9,9-dimethyl-3,4,7,8,10,12-hexahydrobenzo[a]acridin-11-one.
| Compound Name | 12-(1-benzothiophen-2-yl)-9,9-dimethyl-3,4,7,8,10,12-hexahydrobenzo[a]acridin-11-one |
|---|---|
| PubChem CID | 145288336 |
| Molecular Formula | C27H25NOS |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 12-(1-benzothiophen-2-yl)-9,9-dimethyl-3,4,7,8,10,12-hexahydrobenzo[a]acridin-11-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccc3c(c1C2c1cc2ccccc2s1)C=CCC3 |
| InChI | InChI=1S/C27H25NOS/c1-27(2)14-20-25(21(29)15-27)26(23-13-17-8-4-6-10-22(17)30-23)24-18-9-5-3-7-16(18)11-12-19(24)28-20/h4-6,8-13,26,28H,3,7,14-15H2,1-2H3 |
| InChIKey | OGLINZAATORDGD-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |