C26H30N2O2 — CID 4606769
3,3,6,6-tetramethyl-9-(1-methylindol-2-yl)-2,4,5,7,9,10-hexahydroacridine-1,8-dione (PubChem CID 4606769) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-9-(1-methylindol-2-yl)-2,4,5,7,9,10-hexahydroacridine-1,8-dione.
| Compound Name | 3,3,6,6-tetramethyl-9-(1-methylindol-2-yl)-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 4606769 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 3,3,6,6-tetramethyl-9-(1-methylindol-2-yl)-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
| SMILES | Cn1c(C2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)CC(C)(C)C3)cc2ccccc21 |
| InChI | InChI=1S/C26H30N2O2/c1-25(2)11-16-22(20(29)13-25)24(19-10-15-8-6-7-9-18(15)28(19)5)23-17(27-16)12-26(3,4)14-21(23)30/h6-10,24,27H,11-14H2,1-5H3 |
| InChIKey | TXVPPTPQPLJSHB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |