C24H27NOS — CID 145288384
9,9-dimethyl-12-(3-methylthiophen-2-yl)-3,4,7,8,10,12-hexahydrobenzo[a]acridin-11-one;molecular hydrogen (PubChem CID 145288384) has the molecular formula C24H27NOS and a molecular weight of 377.55 g/mol. Its IUPAC name is 9,9-dimethyl-12-(3-methylthiophen-2-yl)-3,4,7,8,10,12-hexahydrobenzo[a]acridin-11-one;molecular hydrogen.
| Compound Name | 9,9-dimethyl-12-(3-methylthiophen-2-yl)-3,4,7,8,10,12-hexahydrobenzo[a]acridin-11-one;molecular hydrogen |
|---|---|
| PubChem CID | 145288384 |
| Molecular Formula | C24H27NOS |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 9,9-dimethyl-12-(3-methylthiophen-2-yl)-3,4,7,8,10,12-hexahydrobenzo[a]acridin-11-one;molecular hydrogen |
| SMILES | Cc1ccsc1C1C2=C(CC(C)(C)CC2=O)Nc2ccc3c(c21)C=CCC3.[H][H] |
| InChI | InChI=1S/C24H25NOS.H2/c1-14-10-11-27-23(14)22-20-16-7-5-4-6-15(16)8-9-17(20)25-18-12-24(2,3)13-19(26)21(18)22;/h5,7-11,22,25H,4,6,12-13H2,1-3H3;1H |
| InChIKey | IKAHILUAMONCIO-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |