C24H25FN2O2S — CID 23889132
N-(2-fluorophenyl)-2,7,7-trimethyl-4-(3-methylthiophen-2-yl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 23889132) has the molecular formula C24H25FN2O2S and a molecular weight of 424.54 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2,7,7-trimethyl-4-(3-methylthiophen-2-yl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-(2-fluorophenyl)-2,7,7-trimethyl-4-(3-methylthiophen-2-yl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 23889132 |
| Molecular Formula | C24H25FN2O2S |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-(2-fluorophenyl)-2,7,7-trimethyl-4-(3-methylthiophen-2-yl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2F)C(c2sccc2C)C2=C(CC(C)(C)CC2=O)N1 |
| InChI | InChI=1S/C24H25FN2O2S/c1-13-9-10-30-22(13)21-19(23(29)27-16-8-6-5-7-15(16)25)14(2)26-17-11-24(3,4)12-18(28)20(17)21/h5-10,21,26H,11-12H2,1-4H3,(H,27,29) |
| InChIKey | YUGNSRMCUWXWLH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |