C23H24BrN3O2S — CID 3301431
N-(5-bromo-2-pyridinyl)-2,7,7-trimethyl-4-(3-methylthiophen-2-yl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 3301431) has the molecular formula C23H24BrN3O2S and a molecular weight of 486.44 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2,7,7-trimethyl-4-(3-methylthiophen-2-yl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-2,7,7-trimethyl-4-(3-methylthiophen-2-yl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 3301431 |
| Molecular Formula | C23H24BrN3O2S |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2,7,7-trimethyl-4-(3-methylthiophen-2-yl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(Br)cn2)C(c2sccc2C)C2=C(CC(C)(C)CC2=O)N1 |
| InChI | InChI=1S/C23H24BrN3O2S/c1-12-7-8-30-21(12)20-18(22(29)27-17-6-5-14(24)11-25-17)13(2)26-15-9-23(3,4)10-16(28)19(15)20/h5-8,11,20,26H,9-10H2,1-4H3,(H,25,27,29) |
| InChIKey | SKSDTIQMKLXXGO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |