C26H30BrN3O2S2 — CID 46906640
N-(5-bromo-2-pyridinyl)-4-(4-ethyl-2-ethylsulfanylthiophen-3-yl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 46906640) has the molecular formula C26H30BrN3O2S2 and a molecular weight of 560.58 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-4-(4-ethyl-2-ethylsulfanylthiophen-3-yl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-4-(4-ethyl-2-ethylsulfanylthiophen-3-yl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 46906640 |
| Molecular Formula | C26H30BrN3O2S2 |
| Molecular Weight | 560.58 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-4-(4-ethyl-2-ethylsulfanylthiophen-3-yl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CCSc1scc(CC)c1C1C(C(=O)Nc2ccc(Br)cn2)=C(C)NC2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C26H30BrN3O2S2/c1-6-15-13-34-25(33-7-2)21(15)23-20(24(32)30-19-9-8-16(27)12-28-19)14(3)29-17-10-26(4,5)11-18(31)22(17)23/h8-9,12-13,23,29H,6-7,10-11H2,1-5H3,(H,28,30,32) |
| InChIKey | FRDFTCMZQNXBIB-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.58 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |