C31H35N3O2 — CID 140931142
N-benzyl-N-[[1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]-1H-indole-2-carboxamide (PubChem CID 140931142) has the molecular formula C31H35N3O2 and a molecular weight of 481.64 g/mol. Its IUPAC name is N-benzyl-N-[[1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]-1H-indole-2-carboxamide.
| Compound Name | N-benzyl-N-[[1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 140931142 |
| Molecular Formula | C31H35N3O2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | N-benzyl-N-[[1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]-1H-indole-2-carboxamide |
| SMILES | COc1cccc(CCN2CCCC(CN(Cc3ccccc3)C(=O)c3cc4ccccc4[nH]3)C2)c1 |
| InChI | InChI=1S/C31H35N3O2/c1-36-28-14-7-11-24(19-28)16-18-33-17-8-12-26(21-33)23-34(22-25-9-3-2-4-10-25)31(35)30-20-27-13-5-6-15-29(27)32-30/h2-7,9-11,13-15,19-20,26,32H,8,12,16-18,21-23H2,1H3 |
| InChIKey | CBNTYAWXCUJKKC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |