C20H28N2O3 — CID 140937019
tert-butyl N-[(2S)-6-phenacyl-6-azaspiro[2.5]octan-2-yl]carbamate (PubChem CID 140937019) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is tert-butyl N-[(2S)-6-phenacyl-6-azaspiro[2.5]octan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-6-phenacyl-6-azaspiro[2.5]octan-2-yl]carbamate |
|---|---|
| PubChem CID | 140937019 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | tert-butyl N-[(2S)-6-phenacyl-6-azaspiro[2.5]octan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC12CCN(CC(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C20H28N2O3/c1-19(2,3)25-18(24)21-17-13-20(17)9-11-22(12-10-20)14-16(23)15-7-5-4-6-8-15/h4-8,17H,9-14H2,1-3H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | ADUFDKSDVQJCCH-KRWDZBQOSA-N |
| XLogP | 3.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |