C36H36N12O3 — CID 140937807
2,4,6-tris[3-(1-propan-2-yltriazol-4-yl)phenoxy]-1,3,5-triazine (PubChem CID 140937807) has the molecular formula C36H36N12O3 and a molecular weight of 684.77 g/mol. Its IUPAC name is 2,4,6-tris[3-(1-propan-2-yltriazol-4-yl)phenoxy]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[3-(1-propan-2-yltriazol-4-yl)phenoxy]-1,3,5-triazine |
|---|---|
| PubChem CID | 140937807 |
| Molecular Formula | C36H36N12O3 |
| Molecular Weight | 684.77 g/mol |
| Exact Mass | 684.30 |
| IUPAC Name | 2,4,6-tris[3-(1-propan-2-yltriazol-4-yl)phenoxy]-1,3,5-triazine |
| SMILES | CC(C)n1cc(-c2cccc(Oc3nc(Oc4cccc(-c5cn(C(C)C)nn5)c4)nc(Oc4cccc(-c5cn(C(C)C)nn5)c4)n3)c2)nn1 |
| InChI | InChI=1S/C36H36N12O3/c1-22(2)46-19-31(40-43-46)25-10-7-13-28(16-25)49-34-37-35(50-29-14-8-11-26(17-29)32-20-47(23(3)4)44-41-32)39-36(38-34)51-30-15-9-12-27(18-30)33-21-48(24(5)6)45-42-33/h7-24H,1-6H3 |
| InChIKey | PEHVAHLBEZMQRL-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 158.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.77 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |