C28H28N2O5 — CID 1409430
N-[4-(dimethylamino)phenyl]-2-[2-(4-methoxyphenyl)-6,8-dimethyl-4-oxochromen-3-yl]oxyacetamide (PubChem CID 1409430) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-[2-(4-methoxyphenyl)-6,8-dimethyl-4-oxochromen-3-yl]oxyacetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-[2-(4-methoxyphenyl)-6,8-dimethyl-4-oxochromen-3-yl]oxyacetamide |
|---|---|
| PubChem CID | 1409430 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-[2-(4-methoxyphenyl)-6,8-dimethyl-4-oxochromen-3-yl]oxyacetamide |
| SMILES | COc1ccc(-c2oc3c(C)cc(C)cc3c(=O)c2OCC(=O)Nc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H28N2O5/c1-17-14-18(2)26-23(15-17)25(32)28(27(35-26)19-6-12-22(33-5)13-7-19)34-16-24(31)29-20-8-10-21(11-9-20)30(3)4/h6-15H,16H2,1-5H3,(H,29,31) |
| InChIKey | VIWKYBTZGZFLAQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|